C9H14N2 — CID 143125324
2-(4,6-dimethyl-1,2-dihydropyridin-2-yl)ethanimine (PubChem CID 143125324) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1,2-dihydropyridin-2-yl)ethanimine.
| Compound Name | 2-(4,6-dimethyl-1,2-dihydropyridin-2-yl)ethanimine |
|---|---|
| PubChem CID | 143125324 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-(4,6-dimethyl-1,2-dihydropyridin-2-yl)ethanimine |
| SMILES | [H]/N=C/CC1C=C(C)C=C(C)N1 |
| InChI | InChI=1S/C9H14N2/c1-7-5-8(2)11-9(6-7)3-4-10/h4-6,9-11H,3H2,1-2H3/b10-4+ |
| InChIKey | BBRDYMKJLNSPAU-ONNFQVAWSA-N |
| XLogP | 1.85 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|