C14H24N2 — CID 91436110
(4E)-4-ethylidene-3-N-propylidenenon-2-ene-3,5-diimine (PubChem CID 91436110) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (4E)-4-ethylidene-3-N-propylidenenon-2-ene-3,5-diimine.
| Compound Name | (4E)-4-ethylidene-3-N-propylidenenon-2-ene-3,5-diimine |
|---|---|
| PubChem CID | 91436110 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (4E)-4-ethylidene-3-N-propylidenenon-2-ene-3,5-diimine |
| SMILES | [H]/N=C(CCCC)/C(=C/C)C(=CC)/N=C/CC |
| InChI | InChI=1S/C14H24N2/c1-5-9-10-13(15)12(7-3)14(8-4)16-11-6-2/h7-8,11,15H,5-6,9-10H2,1-4H3/b12-7-,14-8?,15-13+,16-11+ |
| InChIKey | WYUWLCBQPOUGCE-CZPWGMJVSA-N |
| XLogP | 4.53 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|