C37H42N6O5 — CID 91437432
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-1-methylimidazole-2-carboxamide (PubChem CID 91437432) has the molecular formula C37H42N6O5 and a molecular weight of 650.78 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-1-methylimidazole-2-carboxamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-1-methylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 91437432 |
| Molecular Formula | C37H42N6O5 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-1-methylimidazole-2-carboxamide |
| SMILES | COc1ccc([C@@H](CCCNC(=O)c2nccn2C)N2C(=O)c3cccc(N4CCN(C(C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H42N6O5/c1-25(26-10-6-5-7-11-26)41-20-22-42(23-21-41)30-13-8-12-28-33(30)37(46)43(36(28)45)29(27-15-16-31(47-3)32(24-27)48-4)14-9-17-39-35(44)34-38-18-19-40(34)2/h5-8,10-13,15-16,18-19,24-25,29H,9,14,17,20-23H2,1-4H3,(H,39,44)/t25?,29-/m1/s1 |
| InChIKey | LXEZRYHLMMKKPD-SNSSHHSLSA-N |
| XLogP | 4.87 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|