C32H58N2O3 — CID 91437620
N-[8-(2-butyl-4-ethyl-3-propylcyclohexyl)octyl]-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)acetamide (PubChem CID 91437620) has the molecular formula C32H58N2O3 and a molecular weight of 518.83 g/mol. Its IUPAC name is N-[8-(2-butyl-4-ethyl-3-propylcyclohexyl)octyl]-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)acetamide.
| Compound Name | N-[8-(2-butyl-4-ethyl-3-propylcyclohexyl)octyl]-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)acetamide |
|---|---|
| PubChem CID | 91437620 |
| Molecular Formula | C32H58N2O3 |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.44 |
| IUPAC Name | N-[8-(2-butyl-4-ethyl-3-propylcyclohexyl)octyl]-N-(2,5-dihydroxy-1-propylpyrrol-3-yl)acetamide |
| SMILES | CCCCC1C(CCCCCCCCN(C(C)=O)c2cc(O)n(CCC)c2O)CCC(CC)C1CCC |
| InChI | InChI=1S/C32H58N2O3/c1-6-10-19-29-27(21-20-26(9-4)28(29)17-7-2)18-15-13-11-12-14-16-23-33(25(5)35)30-24-31(36)34(22-8-3)32(30)37/h24,26-29,36-37H,6-23H2,1-5H3 |
| InChIKey | LRTGACSZDMMLGZ-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|