C33H58N2O3 — CID 90698509
N-(1-butyl-2,5-dihydroxypyrrol-3-yl)-N-[8-(3,4-diethyl-2-propylcyclohexyl)octyl]-2-methylprop-2-enamide (PubChem CID 90698509) has the molecular formula C33H58N2O3 and a molecular weight of 530.84 g/mol. Its IUPAC name is N-(1-butyl-2,5-dihydroxypyrrol-3-yl)-N-[8-(3,4-diethyl-2-propylcyclohexyl)octyl]-2-methylprop-2-enamide.
| Compound Name | N-(1-butyl-2,5-dihydroxypyrrol-3-yl)-N-[8-(3,4-diethyl-2-propylcyclohexyl)octyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 90698509 |
| Molecular Formula | C33H58N2O3 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.44 |
| IUPAC Name | N-(1-butyl-2,5-dihydroxypyrrol-3-yl)-N-[8-(3,4-diethyl-2-propylcyclohexyl)octyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(CCCCCCCCC1CCC(CC)C(CC)C1CCC)c1cc(O)n(CCCC)c1O |
| InChI | InChI=1S/C33H58N2O3/c1-7-11-22-35-31(36)24-30(33(35)38)34(32(37)25(5)6)23-17-15-13-12-14-16-19-27-21-20-26(9-3)28(10-4)29(27)18-8-2/h24,26-29,36,38H,5,7-23H2,1-4,6H3 |
| InChIKey | DMKOIFULZFLORE-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|