C53H95N3O8Si — CID 123407031
N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-N-(3-trimethoxysilylpropyl)propanamide (PubChem CID 123407031) has the molecular formula C53H95N3O8Si and a molecular weight of 930.44 g/mol. Its IUPAC name is N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-N-(3-trimethoxysilylpropyl)propanamide.
| Compound Name | N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-N-(3-trimethoxysilylpropyl)propanamide |
|---|---|
| PubChem CID | 123407031 |
| Molecular Formula | C53H95N3O8Si |
| Molecular Weight | 930.44 g/mol |
| Exact Mass | 929.69 |
| IUPAC Name | N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]-N-(3-trimethoxysilylpropyl)propanamide |
| SMILES | CCCCCCCCC1C(CCCCCC)CCC(CCCCCCCCN2C(=O)C=CC2=O)C1CCCCCCCCn1c(O)cc(N(CCC[Si](OC)(OC)OC)C(=O)CC)c1O |
| InChI | InChI=1S/C53H95N3O8Si/c1-7-10-12-14-20-26-33-46-44(31-24-13-11-8-2)35-36-45(32-25-19-15-17-22-28-39-55-50(58)37-38-51(55)59)47(46)34-27-21-16-18-23-29-40-56-52(60)43-48(53(56)61)54(49(57)9-3)41-30-42-65(62-4,63-5)64-6/h37-38,43-47,60-61H,7-36,39-42H2,1-6H3 |
| InChIKey | FZXUBPWSOZXOIU-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.44 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|