C29H49N3O5 — CID 91592458
N-[2,5-dihydroxy-1-[2,2,4-trimethyl-6-(4-oxo-2,7-dihydro-1,3-oxazepin-3-yl)hexyl]pyrrol-3-yl]-N-octylpropanamide (PubChem CID 91592458) has the molecular formula C29H49N3O5 and a molecular weight of 519.73 g/mol. Its IUPAC name is N-[2,5-dihydroxy-1-[2,2,4-trimethyl-6-(4-oxo-2,7-dihydro-1,3-oxazepin-3-yl)hexyl]pyrrol-3-yl]-N-octylpropanamide.
| Compound Name | N-[2,5-dihydroxy-1-[2,2,4-trimethyl-6-(4-oxo-2,7-dihydro-1,3-oxazepin-3-yl)hexyl]pyrrol-3-yl]-N-octylpropanamide |
|---|---|
| PubChem CID | 91592458 |
| Molecular Formula | C29H49N3O5 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.37 |
| IUPAC Name | N-[2,5-dihydroxy-1-[2,2,4-trimethyl-6-(4-oxo-2,7-dihydro-1,3-oxazepin-3-yl)hexyl]pyrrol-3-yl]-N-octylpropanamide |
| SMILES | CCCCCCCCN(C(=O)CC)c1cc(O)n(CC(C)(C)CC(C)CCN2COCC=CC2=O)c1O |
| InChI | InChI=1S/C29H49N3O5/c1-6-8-9-10-11-12-16-31(25(33)7-2)24-19-27(35)32(28(24)36)21-29(4,5)20-23(3)15-17-30-22-37-18-13-14-26(30)34/h13-14,19,23,35-36H,6-12,15-18,20-22H2,1-5H3 |
| InChIKey | VEIGRPYVQZLRPL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|