C78H141N3O5 — CID 123431314
N-[8-(6-butyl-3-hexyl-2-octylcyclohexyl)octyl]-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]acetamide (PubChem CID 123431314) has the molecular formula C78H141N3O5 and a molecular weight of 1201.00 g/mol. Its IUPAC name is N-[8-(6-butyl-3-hexyl-2-octylcyclohexyl)octyl]-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]acetamide.
| Compound Name | N-[8-(6-butyl-3-hexyl-2-octylcyclohexyl)octyl]-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]acetamide |
|---|---|
| PubChem CID | 123431314 |
| Molecular Formula | C78H141N3O5 |
| Molecular Weight | 1201.00 g/mol |
| Exact Mass | 1200.09 |
| IUPAC Name | N-[8-(6-butyl-3-hexyl-2-octylcyclohexyl)octyl]-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]acetamide |
| SMILES | CCCCCCCCC1C(CCCCCC)CCC(CCCC)C1CCCCCCCCN(C(C)=O)c1cc(O)n(CCCCCCCCC2C(CCCCCCCCN3C(=O)C=CC3=O)CCC(CCCCCC)C2CCCCCCCC)c1O |
| InChI | InChI=1S/C78H141N3O5/c1-7-12-17-21-30-40-52-71-67(48-37-19-14-9-3)56-55-66(47-16-11-5)70(71)51-42-32-24-27-34-44-61-79(65(6)82)74-64-77(85)81(78(74)86)63-46-36-28-25-33-43-54-73-69(50-39-29-23-26-35-45-62-80-75(83)59-60-76(80)84)58-57-68(49-38-20-15-10-4)72(73)53-41-31-22-18-13-8-2/h59-60,64,66-73,85-86H,7-58,61-63H2,1-6H3 |
| InChIKey | SVOQTHKKVDRARQ-UHFFFAOYSA-N |
| XLogP | 23.52 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1201.00 |
| LogP ≤ 5 | 23.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|