C24H26F6N2O3S — CID 91438762
N-[benzyl-[(4-methylcyclohexyl)methyl]sulfamoyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 91438762) has the molecular formula C24H26F6N2O3S and a molecular weight of 536.54 g/mol. Its IUPAC name is N-[benzyl-[(4-methylcyclohexyl)methyl]sulfamoyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[benzyl-[(4-methylcyclohexyl)methyl]sulfamoyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91438762 |
| Molecular Formula | C24H26F6N2O3S |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | N-[benzyl-[(4-methylcyclohexyl)methyl]sulfamoyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC1CCC(CN(Cc2ccccc2)S(=O)(=O)NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H26F6N2O3S/c1-16-7-9-18(10-8-16)15-32(14-17-5-3-2-4-6-17)36(34,35)31-22(33)19-11-20(23(25,26)27)13-21(12-19)24(28,29)30/h2-6,11-13,16,18H,7-10,14-15H2,1H3,(H,31,33) |
| InChIKey | DFFZJPIUQVSKBT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |