C23H24F6N2O2 — CID 44539487
N-[[4-[(2-hydroxyphenyl)methylamino]cyclohexyl]methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 44539487) has the molecular formula C23H24F6N2O2 and a molecular weight of 474.45 g/mol. Its IUPAC name is N-[[4-[(2-hydroxyphenyl)methylamino]cyclohexyl]methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[[4-[(2-hydroxyphenyl)methylamino]cyclohexyl]methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44539487 |
| Molecular Formula | C23H24F6N2O2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[[4-[(2-hydroxyphenyl)methylamino]cyclohexyl]methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1CCC(NCc2ccccc2O)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F6N2O2/c24-22(25,26)17-9-16(10-18(11-17)23(27,28)29)21(33)31-12-14-5-7-19(8-6-14)30-13-15-3-1-2-4-20(15)32/h1-4,9-11,14,19,30,32H,5-8,12-13H2,(H,31,33) |
| InChIKey | LKJSZDKFNDRIMG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|