C38H13F15N4 — CID 91439172
5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91439172) has the molecular formula C38H13F15N4 and a molecular weight of 810.52 g/mol. Its IUPAC name is 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91439172 |
| Molecular Formula | C38H13F15N4 |
| Molecular Weight | 810.52 g/mol |
| Exact Mass | 810.09 |
| IUPAC Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3c(F)c(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc2[nH]3)c(F)c1F |
| InChI | InChI=1S/C38H13F15N4/c39-24-21(25(40)31(46)36(51)30(24)45)18-12-3-1-10(54-12)9-11-2-4-13(55-11)19(22-26(41)32(47)37(52)33(48)27(22)42)15-6-8-17(57-15)20(16-7-5-14(18)56-16)23-28(43)34(49)38(53)35(50)29(23)44/h1-9,54-57H |
| InChIKey | QXTKDOXSQNKKRG-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|