C10H16F3NO — CID 91441153
3-ethenyl-6-(2,2,2-trifluoroethoxy)hex-3-en-2-amine (PubChem CID 91441153) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 3-ethenyl-6-(2,2,2-trifluoroethoxy)hex-3-en-2-amine.
| Compound Name | 3-ethenyl-6-(2,2,2-trifluoroethoxy)hex-3-en-2-amine |
|---|---|
| PubChem CID | 91441153 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-ethenyl-6-(2,2,2-trifluoroethoxy)hex-3-en-2-amine |
| SMILES | C=CC(=CCCOCC(F)(F)F)C(C)N |
| InChI | InChI=1S/C10H16F3NO/c1-3-9(8(2)14)5-4-6-15-7-10(11,12)13/h3,5,8H,1,4,6-7,14H2,2H3 |
| InChIKey | BAAJNUXUPCRTGA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|