C14H32O2Si — CID 91441933
2,3-dimethyl-1-(2-trimethylsilylbutan-2-yloxy)pentan-3-ol (PubChem CID 91441933) has the molecular formula C14H32O2Si and a molecular weight of 260.49 g/mol. Its IUPAC name is 2,3-dimethyl-1-(2-trimethylsilylbutan-2-yloxy)pentan-3-ol.
| Compound Name | 2,3-dimethyl-1-(2-trimethylsilylbutan-2-yloxy)pentan-3-ol |
|---|---|
| PubChem CID | 91441933 |
| Molecular Formula | C14H32O2Si |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | 2,3-dimethyl-1-(2-trimethylsilylbutan-2-yloxy)pentan-3-ol |
| SMILES | CCC(C)(O)C(C)COC(C)(CC)[Si](C)(C)C |
| InChI | InChI=1S/C14H32O2Si/c1-9-13(4,15)12(3)11-16-14(5,10-2)17(6,7)8/h12,15H,9-11H2,1-8H3 |
| InChIKey | ANTKHCSBLHNCJT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|