C10H14O3S — CID 91442868
6-ethylsulfonyl-2,3-dimethylphenol (PubChem CID 91442868) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 6-ethylsulfonyl-2,3-dimethylphenol.
| Compound Name | 6-ethylsulfonyl-2,3-dimethylphenol |
|---|---|
| PubChem CID | 91442868 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 6-ethylsulfonyl-2,3-dimethylphenol |
| SMILES | CCS(=O)(=O)c1ccc(C)c(C)c1O |
| InChI | InChI=1S/C10H14O3S/c1-4-14(12,13)9-6-5-7(2)8(3)10(9)11/h5-6,11H,4H2,1-3H3 |
| InChIKey | JEXFFQQBLUIPIW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |