C14H17BrN2O2 — CID 91442947
N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-N-methyl-3-phenylpropanamide (PubChem CID 91442947) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-N-methyl-3-phenylpropanamide.
| Compound Name | N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 91442947 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-N-methyl-3-phenylpropanamide |
| SMILES | CN(CC1C=C(Br)NO1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H17BrN2O2/c1-17(10-12-9-13(15)16-19-12)14(18)8-7-11-5-3-2-4-6-11/h2-6,9,12,16H,7-8,10H2,1H3 |
| InChIKey | DDTKMMYOXCIZEA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|