C15H24N2O3 — CID 91445252
tert-butyl N-[(1S,5R)-3-methylidene-7-nitroso-9-bicyclo[3.3.1]nonanyl]carbamate (PubChem CID 91445252) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl N-[(1S,5R)-3-methylidene-7-nitroso-9-bicyclo[3.3.1]nonanyl]carbamate.
| Compound Name | tert-butyl N-[(1S,5R)-3-methylidene-7-nitroso-9-bicyclo[3.3.1]nonanyl]carbamate |
|---|---|
| PubChem CID | 91445252 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | tert-butyl N-[(1S,5R)-3-methylidene-7-nitroso-9-bicyclo[3.3.1]nonanyl]carbamate |
| SMILES | C=C1C[C@@H]2CC(N=O)C[C@H](C1)C2NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O3/c1-9-5-10-7-12(17-19)8-11(6-9)13(10)16-14(18)20-15(2,3)4/h10-13H,1,5-8H2,2-4H3,(H,16,18)/t10-,11+,12?,13? |
| InChIKey | LRBNRUIPXSHMSU-MPEURRAXSA-N |
| XLogP | 3.39 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|