C24H17N3O3S — CID 91451913
5-hydroxy-3-methoxy-2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-thiophen-2-ylpyridine-4-carboxamide (PubChem CID 91451913) has the molecular formula C24H17N3O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is 5-hydroxy-3-methoxy-2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-thiophen-2-ylpyridine-4-carboxamide.
| Compound Name | 5-hydroxy-3-methoxy-2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-thiophen-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 91451913 |
| Molecular Formula | C24H17N3O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 5-hydroxy-3-methoxy-2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-thiophen-2-ylpyridine-4-carboxamide |
| SMILES | COc1c(-c2ccc(C#Cc3cccnc3)cc2)nc(-c2cccs2)c(O)c1C(N)=O |
| InChI | InChI=1S/C24H17N3O3S/c1-30-23-19(24(25)29)22(28)21(18-5-3-13-31-18)27-20(23)17-10-8-15(9-11-17)6-7-16-4-2-12-26-14-16/h2-5,8-14,28H,1H3,(H2,25,29) |
| InChIKey | WZVJVFKQNFPIQT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|