C25H18N4O4S — CID 68756203
methyl 2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-(pyridin-3-ylsulfonylamino)pyridine-4-carboxylate (PubChem CID 68756203) has the molecular formula C25H18N4O4S and a molecular weight of 470.51 g/mol. Its IUPAC name is methyl 2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-(pyridin-3-ylsulfonylamino)pyridine-4-carboxylate.
| Compound Name | methyl 2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-(pyridin-3-ylsulfonylamino)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 68756203 |
| Molecular Formula | C25H18N4O4S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | methyl 2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-(pyridin-3-ylsulfonylamino)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2cccnc2)nc(-c2ccc(C#Cc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C25H18N4O4S/c1-33-25(30)21-14-23(28-24(15-21)29-34(31,32)22-5-3-13-27-17-22)20-10-8-18(9-11-20)6-7-19-4-2-12-26-16-19/h2-5,8-17H,1H3,(H,28,29) |
| InChIKey | VRUUXYNPRHVFHR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|