C30H27N5O2 — CID 68757085
methyl 2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pyridine-4-carboxylate (PubChem CID 68757085) has the molecular formula C30H27N5O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is methyl 2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pyridine-4-carboxylate.
| Compound Name | methyl 2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 68757085 |
| Molecular Formula | C30H27N5O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | methyl 2-[4-(2-pyridin-3-ylethynyl)phenyl]-6-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(C#Cc3cccnc3)cc2)nc(N2CCN(Cc3cccnc3)CC2)c1 |
| InChI | InChI=1S/C30H27N5O2/c1-37-30(36)27-18-28(26-10-8-23(9-11-26)6-7-24-4-2-12-31-20-24)33-29(19-27)35-16-14-34(15-17-35)22-25-5-3-13-32-21-25/h2-5,8-13,18-21H,14-17,22H2,1H3 |
| InChIKey | RSBIIIQHUMBZKP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|