C21H17N3O4S — CID 68759808
methyl 2-(methanesulfonamido)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate (PubChem CID 68759808) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is methyl 2-(methanesulfonamido)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate.
| Compound Name | methyl 2-(methanesulfonamido)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 68759808 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | methyl 2-(methanesulfonamido)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(NS(C)(=O)=O)nc(-c2ccc(C#Cc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C21H17N3O4S/c1-28-21(25)18-12-19(23-20(13-18)24-29(2,26)27)17-9-7-15(8-10-17)5-6-16-4-3-11-22-14-16/h3-4,7-14H,1-2H3,(H,23,24) |
| InChIKey | GMSHDKDLZVNZLG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|