C23H20N4O3 — CID 68756538
methyl 2-(ethylcarbamoylamino)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate (PubChem CID 68756538) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is methyl 2-(ethylcarbamoylamino)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate.
| Compound Name | methyl 2-(ethylcarbamoylamino)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 68756538 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | methyl 2-(ethylcarbamoylamino)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate |
| SMILES | CCNC(=O)Nc1cc(C(=O)OC)cc(-c2ccc(C#Cc3cccnc3)cc2)n1 |
| InChI | InChI=1S/C23H20N4O3/c1-3-25-23(29)27-21-14-19(22(28)30-2)13-20(26-21)18-10-8-16(9-11-18)6-7-17-5-4-12-24-15-17/h4-5,8-15H,3H2,1-2H3,(H2,25,26,27,29) |
| InChIKey | CHNCAMJSNSNCDO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|