C21H21N5O4 — CID 89034356
N-hydroxy-2-(2-methoxyethylcarbamoylamino)-6-(4-pyridin-3-ylphenyl)pyridine-4-carboxamide (PubChem CID 89034356) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-hydroxy-2-(2-methoxyethylcarbamoylamino)-6-(4-pyridin-3-ylphenyl)pyridine-4-carboxamide.
| Compound Name | N-hydroxy-2-(2-methoxyethylcarbamoylamino)-6-(4-pyridin-3-ylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 89034356 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-hydroxy-2-(2-methoxyethylcarbamoylamino)-6-(4-pyridin-3-ylphenyl)pyridine-4-carboxamide |
| SMILES | COCCNC(=O)Nc1cc(C(=O)NO)cc(-c2ccc(-c3cccnc3)cc2)n1 |
| InChI | InChI=1S/C21H21N5O4/c1-30-10-9-23-21(28)25-19-12-17(20(27)26-29)11-18(24-19)15-6-4-14(5-7-15)16-3-2-8-22-13-16/h2-8,11-13,29H,9-10H2,1H3,(H,26,27)(H2,23,24,25,28) |
| InChIKey | YDXNPJIHYRLUKX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|