C27H19N3O4 — CID 68755887
methyl 2-[(4-hydroxybenzoyl)amino]-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate (PubChem CID 68755887) has the molecular formula C27H19N3O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is methyl 2-[(4-hydroxybenzoyl)amino]-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate.
| Compound Name | methyl 2-[(4-hydroxybenzoyl)amino]-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 68755887 |
| Molecular Formula | C27H19N3O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | methyl 2-[(4-hydroxybenzoyl)amino]-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(O)cc2)nc(-c2ccc(C#Cc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C27H19N3O4/c1-34-27(33)22-15-24(29-25(16-22)30-26(32)21-10-12-23(31)13-11-21)20-8-6-18(7-9-20)4-5-19-3-2-14-28-17-19/h2-3,6-17,31H,1H3,(H,29,30,32) |
| InChIKey | FCMAOOOMZOHIQQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|