C29H52 — CID 91452398
cis-(1R,3S)-2-[(2R,6S)-2,6-dimethyl-4-pent-2-en-3-ylcyclohexyl]-1,3-dimethyl-5-[(2S)-2-methylheptylidene]cyclohexane (PubChem CID 91452398) has the molecular formula C29H52 and a molecular weight of 400.74 g/mol. Its IUPAC name is cis-(1R,3S)-2-[(2R,6S)-2,6-dimethyl-4-pent-2-en-3-ylcyclohexyl]-1,3-dimethyl-5-[(2S)-2-methylheptylidene]cyclohexane.
| Compound Name | cis-(1R,3S)-2-[(2R,6S)-2,6-dimethyl-4-pent-2-en-3-ylcyclohexyl]-1,3-dimethyl-5-[(2S)-2-methylheptylidene]cyclohexane |
|---|---|
| PubChem CID | 91452398 |
| Molecular Formula | C29H52 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.41 |
| IUPAC Name | cis-(1R,3S)-2-[(2R,6S)-2,6-dimethyl-4-pent-2-en-3-ylcyclohexyl]-1,3-dimethyl-5-[(2S)-2-methylheptylidene]cyclohexane |
| SMILES | CC=C(CC)C1C[C@@H](C)C(C2[C@H](C)C/C(=C/[C@@H](C)CCCCC)C[C@@H]2C)[C@@H](C)C1 |
| InChI | InChI=1S/C29H52/c1-9-12-13-14-20(4)15-25-16-21(5)28(22(6)17-25)29-23(7)18-27(19-24(29)8)26(10-2)11-3/h10,15,20-24,27-29H,9,11-14,16-19H2,1-8H3/b25-15-,26-10?/t20-,21+,22-,23-,24+,27?,28?,29?/m0/s1 |
| InChIKey | DYFKDTXQBJEAOA-RQWLZNGBSA-N |
| XLogP | 9.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|