C19H20F2N2O4 — CID 91455750
ethyl 4-(1-cyclopentyl-6,7-difluoro-2,4-dioxoquinazolin-3-yl)but-2-enoate (PubChem CID 91455750) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is ethyl 4-(1-cyclopentyl-6,7-difluoro-2,4-dioxoquinazolin-3-yl)but-2-enoate.
| Compound Name | ethyl 4-(1-cyclopentyl-6,7-difluoro-2,4-dioxoquinazolin-3-yl)but-2-enoate |
|---|---|
| PubChem CID | 91455750 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | ethyl 4-(1-cyclopentyl-6,7-difluoro-2,4-dioxoquinazolin-3-yl)but-2-enoate |
| SMILES | CCOC(=O)C=CCn1c(=O)c2cc(F)c(F)cc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C19H20F2N2O4/c1-2-27-17(24)8-5-9-22-18(25)13-10-14(20)15(21)11-16(13)23(19(22)26)12-6-3-4-7-12/h5,8,10-12H,2-4,6-7,9H2,1H3 |
| InChIKey | XPJINHHSVAPCQS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|