C23H31FN4O4 — CID 91029545
ethyl 4-[[7-(cyclohexylamino)-6-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-3-yl]amino]but-2-enoate (PubChem CID 91029545) has the molecular formula C23H31FN4O4 and a molecular weight of 446.52 g/mol. Its IUPAC name is ethyl 4-[[7-(cyclohexylamino)-6-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-3-yl]amino]but-2-enoate.
| Compound Name | ethyl 4-[[7-(cyclohexylamino)-6-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-3-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 91029545 |
| Molecular Formula | C23H31FN4O4 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | ethyl 4-[[7-(cyclohexylamino)-6-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-3-yl]amino]but-2-enoate |
| SMILES | CCOC(=O)C=CCNn1c(=O)c2cc(F)c(NC3CCCCC3)cc2n(C(C)C)c1=O |
| InChI | InChI=1S/C23H31FN4O4/c1-4-32-21(29)11-8-12-25-28-22(30)17-13-18(24)19(26-16-9-6-5-7-10-16)14-20(17)27(15(2)3)23(28)31/h8,11,13-16,25-26H,4-7,9-10,12H2,1-3H3 |
| InChIKey | DHAWCNHLDKYVAK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|