C21H28FN3O5 — CID 59311084
4-[7-(cyclohexylamino)-6-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-3-yl]oxybutanoic acid (PubChem CID 59311084) has the molecular formula C21H28FN3O5 and a molecular weight of 421.47 g/mol. Its IUPAC name is 4-[7-(cyclohexylamino)-6-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-3-yl]oxybutanoic acid.
| Compound Name | 4-[7-(cyclohexylamino)-6-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-3-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 59311084 |
| Molecular Formula | C21H28FN3O5 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-[7-(cyclohexylamino)-6-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-3-yl]oxybutanoic acid |
| SMILES | CC(C)n1c(=O)n(OCCCC(=O)O)c(=O)c2cc(F)c(NC3CCCCC3)cc21 |
| InChI | InChI=1S/C21H28FN3O5/c1-13(2)24-18-12-17(23-14-7-4-3-5-8-14)16(22)11-15(18)20(28)25(21(24)29)30-10-6-9-19(26)27/h11-14,23H,3-10H2,1-2H3,(H,26,27) |
| InChIKey | GSGMZSIRXYCAFL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|