C51H80O18 — CID 91456315
1-O-[5-[4,4-diacetyl-7-[5-(4,4-diacetyl-7-ethoxy-7-oxoheptanoyl)oxy-4,4-dimethylpentoxy]-7-oxoheptanoyl]oxy-2,2-dimethylpentyl] 7-O-ethyl 4,4-diacetylheptanedioate (PubChem CID 91456315) has the molecular formula C51H80O18 and a molecular weight of 981.18 g/mol. Its IUPAC name is 1-O-[5-[4,4-diacetyl-7-[5-(4,4-diacetyl-7-ethoxy-7-oxoheptanoyl)oxy-4,4-dimethylpentoxy]-7-oxoheptanoyl]oxy-2,2-dimethylpentyl] 7-O-ethyl 4,4-diacetylheptanedioate.
| Compound Name | 1-O-[5-[4,4-diacetyl-7-[5-(4,4-diacetyl-7-ethoxy-7-oxoheptanoyl)oxy-4,4-dimethylpentoxy]-7-oxoheptanoyl]oxy-2,2-dimethylpentyl] 7-O-ethyl 4,4-diacetylheptanedioate |
|---|---|
| PubChem CID | 91456315 |
| Molecular Formula | C51H80O18 |
| Molecular Weight | 981.18 g/mol |
| Exact Mass | 980.53 |
| IUPAC Name | 1-O-[5-[4,4-diacetyl-7-[5-(4,4-diacetyl-7-ethoxy-7-oxoheptanoyl)oxy-4,4-dimethylpentoxy]-7-oxoheptanoyl]oxy-2,2-dimethylpentyl] 7-O-ethyl 4,4-diacetylheptanedioate |
| SMILES | CCOC(=O)CCC(CCC(=O)OCC(C)(C)CCCOC(=O)CCC(CCC(=O)OCCCC(C)(C)COC(=O)CCC(CCC(=O)OCC)(C(C)=O)C(C)=O)(C(C)=O)C(C)=O)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C51H80O18/c1-13-64-41(58)17-25-49(35(3)52,36(4)53)29-21-45(62)68-33-47(9,10)23-15-31-66-43(60)19-27-51(39(7)56,40(8)57)28-20-44(61)67-32-16-24-48(11,12)34-69-46(63)22-30-50(37(5)54,38(6)55)26-18-42(59)65-14-2/h13-34H2,1-12H3 |
| InChIKey | XNIIFAWRWPFCRZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 260.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.18 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|