About 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine
4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine (PubChem CID 91460554) has the molecular formula C6H5N5S
and a molecular weight of 179.21 g/mol. Its IUPAC name is 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine.
Molecular Properties
| Compound Name | 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine |
| PubChem CID | 91460554 |
| Molecular Formula | C6H5N5S |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine |
| SMILES | Sn1ncnc1-c1ccncn1 |
| InChI | InChI=1S/C6H5N5S/c12-11-6(9-4-10-11)5-1-2-7-3-8-5/h1-4,12H |
| InChIKey | NHJUSBDOYFTFAM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine?
The IUPAC name of 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine (CID 91460554) is 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine.
What is the SMILES notation for 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine?
The canonical SMILES for 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine is Sn1ncnc1-c1ccncn1.
What is the InChIKey of 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine?
The InChIKey is NHJUSBDOYFTFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5S/c12-11-6(9-4-10-11)5-1-2-7-3-8-5/h1-4,12H.
What are the key properties of 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine?
4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine has a molecular weight of 179.21 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrimidine is sourced from PubChem (CID 91460554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).