C18H34N4O3 — CID 91460623
3-[[6-(butan-2-ylideneamino)-2-methylhexanoyl]amino]-N,N'-dimethylpentanediamide (PubChem CID 91460623) has the molecular formula C18H34N4O3 and a molecular weight of 354.50 g/mol. Its IUPAC name is 3-[[6-(butan-2-ylideneamino)-2-methylhexanoyl]amino]-N,N'-dimethylpentanediamide.
| Compound Name | 3-[[6-(butan-2-ylideneamino)-2-methylhexanoyl]amino]-N,N'-dimethylpentanediamide |
|---|---|
| PubChem CID | 91460623 |
| Molecular Formula | C18H34N4O3 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 3-[[6-(butan-2-ylideneamino)-2-methylhexanoyl]amino]-N,N'-dimethylpentanediamide |
| SMILES | CC/C(C)=N/CCCCC(C)C(=O)NC(CC(=O)NC)CC(=O)NC |
| InChI | InChI=1S/C18H34N4O3/c1-6-14(3)21-10-8-7-9-13(2)18(25)22-15(11-16(23)19-4)12-17(24)20-5/h13,15H,6-12H2,1-5H3,(H,19,23)(H,20,24)(H,22,25)/b21-14+ |
| InChIKey | ABHHWWMLTDTEOH-KGENOOAVSA-N |
| XLogP | 1.42 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|