C18H39N5O — CID 90699694
N-[2-[[3-(2-aminoethylamino)-3-methylbutyl]amino]-2-methylpropyl]-4-imino-5-methylhexanamide (PubChem CID 90699694) has the molecular formula C18H39N5O and a molecular weight of 341.54 g/mol. Its IUPAC name is N-[2-[[3-(2-aminoethylamino)-3-methylbutyl]amino]-2-methylpropyl]-4-imino-5-methylhexanamide.
| Compound Name | N-[2-[[3-(2-aminoethylamino)-3-methylbutyl]amino]-2-methylpropyl]-4-imino-5-methylhexanamide |
|---|---|
| PubChem CID | 90699694 |
| Molecular Formula | C18H39N5O |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.32 |
| IUPAC Name | N-[2-[[3-(2-aminoethylamino)-3-methylbutyl]amino]-2-methylpropyl]-4-imino-5-methylhexanamide |
| SMILES | [H]/N=C(/CCC(=O)NCC(C)(C)NCCC(C)(C)NCCN)C(C)C |
| InChI | InChI=1S/C18H39N5O/c1-14(2)15(20)7-8-16(24)21-13-18(5,6)22-11-9-17(3,4)23-12-10-19/h14,20,22-23H,7-13,19H2,1-6H3,(H,21,24)/b20-15- |
| InChIKey | FUASKUMJXPTBIW-HKWRFOASSA-N |
| XLogP | 1.64 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|