C26H25ClFN5O3S — CID 91460831
5-chloro-N-[[(5S)-3-[3-fluoro-4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylbenzamide (PubChem CID 91460831) has the molecular formula C26H25ClFN5O3S and a molecular weight of 542.04 g/mol. Its IUPAC name is 5-chloro-N-[[(5S)-3-[3-fluoro-4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylbenzamide.
| Compound Name | 5-chloro-N-[[(5S)-3-[3-fluoro-4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 91460831 |
| Molecular Formula | C26H25ClFN5O3S |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 5-chloro-N-[[(5S)-3-[3-fluoro-4-(4-pyridin-4-ylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-sulfanylbenzamide |
| SMILES | O=C(NC[C@H]1CN(c2ccc(N3CCN(c4ccncc4)CC3)c(F)c2)C(=O)O1)c1cc(Cl)ccc1S |
| InChI | InChI=1S/C26H25ClFN5O3S/c27-17-1-4-24(37)21(13-17)25(34)30-15-20-16-33(26(35)36-20)19-2-3-23(22(28)14-19)32-11-9-31(10-12-32)18-5-7-29-8-6-18/h1-8,13-14,20,37H,9-12,15-16H2,(H,30,34)/t20-/m0/s1 |
| InChIKey | VHNFSJACILWVEH-FQEVSTJZSA-N |
| XLogP | 4.24 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|