C47H28N2O2S2+2 — CID 91463545
2,2'-dinaphthalen-2-yl-6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] (PubChem CID 91463545) has the molecular formula C47H28N2O2S2+2 and a molecular weight of 716.89 g/mol. Its IUPAC name is 2,2'-dinaphthalen-2-yl-6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium].
| Compound Name | 2,2'-dinaphthalen-2-yl-6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 91463545 |
| Molecular Formula | C47H28N2O2S2+2 |
| Molecular Weight | 716.89 g/mol |
| Exact Mass | 716.16 |
| IUPAC Name | 2,2'-dinaphthalen-2-yl-6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
| SMILES | c1ccc2cc(-c3ccc4c(c3)-c3sc5ccccc5[n+]3C3(O4)Oc4ccc(-c5ccc6ccccc6c5)cc4-c4sc5ccccc5[n+]43)ccc2c1 |
| InChI | InChI=1S/C47H28N2O2S2/c1-3-11-31-25-33(19-17-29(31)9-1)35-21-23-41-37(27-35)45-48(39-13-5-7-15-43(39)52-45)47(50-41)49-40-14-6-8-16-44(40)53-46(49)38-28-36(22-24-42(38)51-47)34-20-18-30-10-2-4-12-32(30)26-34/h1-28H/q+2 |
| InChIKey | HCOXOVICAXEFPF-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.89 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|