C18H18Cl2FO4P — CID 91463848
[2-[3,5-dichloro-4-[(4-fluoro-2-propylphenyl)methyl]phenyl]-2-oxoethyl]phosphonic acid (PubChem CID 91463848) has the molecular formula C18H18Cl2FO4P and a molecular weight of 419.22 g/mol. Its IUPAC name is [2-[3,5-dichloro-4-[(4-fluoro-2-propylphenyl)methyl]phenyl]-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[3,5-dichloro-4-[(4-fluoro-2-propylphenyl)methyl]phenyl]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 91463848 |
| Molecular Formula | C18H18Cl2FO4P |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | [2-[3,5-dichloro-4-[(4-fluoro-2-propylphenyl)methyl]phenyl]-2-oxoethyl]phosphonic acid |
| SMILES | CCCc1cc(F)ccc1Cc1c(Cl)cc(C(=O)CP(=O)(O)O)cc1Cl |
| InChI | InChI=1S/C18H18Cl2FO4P/c1-2-3-11-6-14(21)5-4-12(11)7-15-16(19)8-13(9-17(15)20)18(22)10-26(23,24)25/h4-6,8-9H,2-3,7,10H2,1H3,(H2,23,24,25) |
| InChIKey | MLRGLUPOTOSVTL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|