C25H28F11NO4 — CID 91468309
tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-8-tricyclo[5.2.1.02,6]decanyl]-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 91468309) has the molecular formula C25H28F11NO4 and a molecular weight of 615.48 g/mol. Its IUPAC name is tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-8-tricyclo[5.2.1.02,6]decanyl]-3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-8-tricyclo[5.2.1.02,6]decanyl]-3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 91468309 |
| Molecular Formula | C25H28F11NO4 |
| Molecular Weight | 615.48 g/mol |
| Exact Mass | 615.18 |
| IUPAC Name | tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-8-tricyclo[5.2.1.02,6]decanyl]-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | CCn1c(O)c(C)c(C2C(C(C)(C(=O)OC(C)(C)C)C(F)(F)F)C3CC2C2(F)C(F)(F)C(F)(F)C(F)(F)C32F)c1O |
| InChI | InChI=1S/C25H28F11NO4/c1-7-37-15(38)9(2)12(16(37)39)13-10-8-11(14(13)19(6,25(34,35)36)17(40)41-18(3,4)5)21(27)20(10,26)22(28,29)24(32,33)23(21,30)31/h10-11,13-14,38-39H,7-8H2,1-6H3 |
| InChIKey | AKISBKNRVJJRGB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|