C26H30F11NO4 — CID 91542278
tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-8-tricyclo[5.2.2.02,6]undecanyl]-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 91542278) has the molecular formula C26H30F11NO4 and a molecular weight of 629.51 g/mol. Its IUPAC name is tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-8-tricyclo[5.2.2.02,6]undecanyl]-3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-8-tricyclo[5.2.2.02,6]undecanyl]-3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 91542278 |
| Molecular Formula | C26H30F11NO4 |
| Molecular Weight | 629.51 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-8-tricyclo[5.2.2.02,6]undecanyl]-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | CCn1c(O)c(C)c(C2C(C(C)(C(=O)OC(C)(C)C)C(F)(F)F)C3CCC2C2(F)C(F)(F)C(F)(F)C(F)(F)C32F)c1O |
| InChI | InChI=1S/C26H30F11NO4/c1-7-38-16(39)10(2)13(17(38)40)14-11-8-9-12(15(14)20(6,26(35,36)37)18(41)42-19(3,4)5)22(28)21(11,27)23(29,30)25(33,34)24(22,31)32/h11-12,14-15,39-40H,7-9H2,1-6H3 |
| InChIKey | XOIKOPDZMQGPJW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.51 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|