C24H26F11NO4S — CID 91470129
tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-10-thiatricyclo[5.2.1.02,6]decan-8-yl]-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 91470129) has the molecular formula C24H26F11NO4S and a molecular weight of 633.52 g/mol. Its IUPAC name is tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-10-thiatricyclo[5.2.1.02,6]decan-8-yl]-3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-10-thiatricyclo[5.2.1.02,6]decan-8-yl]-3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 91470129 |
| Molecular Formula | C24H26F11NO4S |
| Molecular Weight | 633.52 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | tert-butyl 2-[9-(1-ethyl-2,5-dihydroxy-4-methylpyrrol-3-yl)-2,3,3,4,4,5,5,6-octafluoro-10-thiatricyclo[5.2.1.02,6]decan-8-yl]-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | CCn1c(O)c(C)c(C2C(C(C)(C(=O)OC(C)(C)C)C(F)(F)F)C3SC2C2(F)C(F)(F)C(F)(F)C(F)(F)C32F)c1O |
| InChI | InChI=1S/C24H26F11NO4S/c1-7-36-14(37)8(2)9(15(36)38)10-11(18(6,24(33,34)35)16(39)40-17(3,4)5)13-20(26)19(25,12(10)41-13)21(27,28)23(31,32)22(20,29)30/h10-13,37-38H,7H2,1-6H3 |
| InChIKey | JLRIELAUZBFVKX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|