C23H22BrClNO7PS — CID 91468580
[2-[2-(3-bromophenyl)ethenylamino]-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid (PubChem CID 91468580) has the molecular formula C23H22BrClNO7PS and a molecular weight of 602.83 g/mol. Its IUPAC name is [2-[2-(3-bromophenyl)ethenylamino]-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [2-[2-(3-bromophenyl)ethenylamino]-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 91468580 |
| Molecular Formula | C23H22BrClNO7PS |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 600.97 |
| IUPAC Name | [2-[2-(3-bromophenyl)ethenylamino]-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(O)C(C(=O)NC=Cc1cccc(Br)c1)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H22BrClNO7PS/c1-14(2)33-23(28)31-13-32-34(29,30)21(19-12-35-20-7-6-17(25)11-18(19)20)22(27)26-9-8-15-4-3-5-16(24)10-15/h3-12,14,21H,13H2,1-2H3,(H,26,27)(H,29,30) |
| InChIKey | GGXUNTURFSOYJE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|