C24H23ClF2NO6PS — CID 140587370
[1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(2,3-difluorophenyl)ethenyl]amino]-2-oxoethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 140587370) has the molecular formula C24H23ClF2NO6PS and a molecular weight of 557.94 g/mol. Its IUPAC name is [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(2,3-difluorophenyl)ethenyl]amino]-2-oxoethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(2,3-difluorophenyl)ethenyl]amino]-2-oxoethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 140587370 |
| Molecular Formula | C24H23ClF2NO6PS |
| Molecular Weight | 557.94 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(2,3-difluorophenyl)ethenyl]amino]-2-oxoethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(O)C(C(=O)N/C=C/c1cccc(F)c1F)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H23ClF2NO6PS/c1-24(2,3)23(30)33-13-34-35(31,32)21(17-12-36-19-8-7-15(25)11-16(17)19)22(29)28-10-9-14-5-4-6-18(26)20(14)27/h4-12,21H,13H2,1-3H3,(H,28,29)(H,31,32)/b10-9+ |
| InChIKey | ZIZNUKFXWBUSFY-MDZDMXLPSA-N |
| XLogP | 6.41 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.94 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|