C23H21Br2ClNO7PS — CID 140587369
[1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(3,5-dibromophenyl)ethenyl]amino]-2-oxoethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid (PubChem CID 140587369) has the molecular formula C23H21Br2ClNO7PS and a molecular weight of 681.72 g/mol. Its IUPAC name is [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(3,5-dibromophenyl)ethenyl]amino]-2-oxoethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(3,5-dibromophenyl)ethenyl]amino]-2-oxoethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 140587369 |
| Molecular Formula | C23H21Br2ClNO7PS |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 678.88 |
| IUPAC Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(3,5-dibromophenyl)ethenyl]amino]-2-oxoethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(O)C(C(=O)N/C=C/c1cc(Br)cc(Br)c1)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H21Br2ClNO7PS/c1-13(2)34-23(29)32-12-33-35(30,31)21(19-11-36-20-4-3-17(26)10-18(19)20)22(28)27-6-5-14-7-15(24)9-16(25)8-14/h3-11,13,21H,12H2,1-2H3,(H,27,28)(H,30,31)/b6-5+ |
| InChIKey | YEAUBEGIYFADCO-AATRIKPKSA-N |
| XLogP | 7.63 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|