C24H38ClN3O2 — CID 91468660
4-[4-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-methoxybutanamide (PubChem CID 91468660) has the molecular formula C24H38ClN3O2 and a molecular weight of 436.04 g/mol. Its IUPAC name is 4-[4-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-methoxybutanamide.
| Compound Name | 4-[4-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 91468660 |
| Molecular Formula | C24H38ClN3O2 |
| Molecular Weight | 436.04 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 4-[4-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-methoxybutanamide |
| SMILES | COC(CCC(N)=O)C1CCC(CCN2CCN(c3cccc(Cl)c3C)CC2)CC1 |
| InChI | InChI=1S/C24H38ClN3O2/c1-18-21(25)4-3-5-22(18)28-16-14-27(15-17-28)13-12-19-6-8-20(9-7-19)23(30-2)10-11-24(26)29/h3-5,19-20,23H,6-17H2,1-2H3,(H2,26,29) |
| InChIKey | WTBQYQXUPFRSLR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.04 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |