C24H37ClN4O — CID 143598737
5-[[4-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]amino]-5-hydroxypentanenitrile (PubChem CID 143598737) has the molecular formula C24H37ClN4O and a molecular weight of 433.04 g/mol. Its IUPAC name is 5-[[4-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]amino]-5-hydroxypentanenitrile.
| Compound Name | 5-[[4-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]amino]-5-hydroxypentanenitrile |
|---|---|
| PubChem CID | 143598737 |
| Molecular Formula | C24H37ClN4O |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 5-[[4-[2-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]amino]-5-hydroxypentanenitrile |
| SMILES | Cc1c(Cl)cccc1N1CCN(CCC2CCC(NC(O)CCCC#N)CC2)CC1 |
| InChI | InChI=1S/C24H37ClN4O/c1-19-22(25)5-4-6-23(19)29-17-15-28(16-18-29)14-12-20-8-10-21(11-9-20)27-24(30)7-2-3-13-26/h4-6,20-21,24,27,30H,2-3,7-12,14-18H2,1H3 |
| InChIKey | AYJXSPFEAIDGQN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|