C25H32F4N4O — CID 162564591
6-[4-[2-[4-[2-fluoro-3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]-6-imino-5-oxohexanenitrile (PubChem CID 162564591) has the molecular formula C25H32F4N4O and a molecular weight of 480.55 g/mol. Its IUPAC name is 6-[4-[2-[4-[2-fluoro-3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]-6-imino-5-oxohexanenitrile.
| Compound Name | 6-[4-[2-[4-[2-fluoro-3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]-6-imino-5-oxohexanenitrile |
|---|---|
| PubChem CID | 162564591 |
| Molecular Formula | C25H32F4N4O |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 6-[4-[2-[4-[2-fluoro-3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]-6-imino-5-oxohexanenitrile |
| SMILES | [H]/N=C(\C(=O)CCCC#N)C1CCC(CCN2CCN(c3cccc(C(F)(F)F)c3F)CC2)CC1 |
| InChI | InChI=1S/C25H32F4N4O/c26-23-20(25(27,28)29)4-3-5-21(23)33-16-14-32(15-17-33)13-11-18-7-9-19(10-8-18)24(31)22(34)6-1-2-12-30/h3-5,18-19,31H,1-2,6-11,13-17H2/b31-24- |
| InChIKey | OJNZBLJHKVGGJD-QLTSDVKISA-N |
| XLogP | 5.45 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|