C30H38ClFN4O2 — CID 118481210
N-[4-[4-[2-[4-(3-chloro-2-fluorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-cyanobutyl]-2-hydroxybenzamide (PubChem CID 118481210) has the molecular formula C30H38ClFN4O2 and a molecular weight of 541.11 g/mol. Its IUPAC name is N-[4-[4-[2-[4-(3-chloro-2-fluorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-cyanobutyl]-2-hydroxybenzamide.
| Compound Name | N-[4-[4-[2-[4-(3-chloro-2-fluorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-cyanobutyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 118481210 |
| Molecular Formula | C30H38ClFN4O2 |
| Molecular Weight | 541.11 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | N-[4-[4-[2-[4-(3-chloro-2-fluorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-cyanobutyl]-2-hydroxybenzamide |
| SMILES | N#CC(CCCNC(=O)c1ccccc1O)C1CCC(CCN2CCN(c3cccc(Cl)c3F)CC2)CC1 |
| InChI | InChI=1S/C30H38ClFN4O2/c31-26-7-3-8-27(29(26)32)36-19-17-35(18-20-36)16-14-22-10-12-23(13-11-22)24(21-33)5-4-15-34-30(38)25-6-1-2-9-28(25)37/h1-3,6-9,22-24,37H,4-5,10-20H2,(H,34,38) |
| InChIKey | LSKDGYMLXMPOCE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.11 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|