C31H38ClN5O2 — CID 118481141
N-[4-[4-[2-[4-(2-chloro-5-cyanophenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-cyanobutyl]-2-hydroxybenzamide (PubChem CID 118481141) has the molecular formula C31H38ClN5O2 and a molecular weight of 548.13 g/mol. Its IUPAC name is N-[4-[4-[2-[4-(2-chloro-5-cyanophenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-cyanobutyl]-2-hydroxybenzamide.
| Compound Name | N-[4-[4-[2-[4-(2-chloro-5-cyanophenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-cyanobutyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 118481141 |
| Molecular Formula | C31H38ClN5O2 |
| Molecular Weight | 548.13 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-[4-[4-[2-[4-(2-chloro-5-cyanophenyl)piperazin-1-yl]ethyl]cyclohexyl]-4-cyanobutyl]-2-hydroxybenzamide |
| SMILES | N#Cc1ccc(Cl)c(N2CCN(CCC3CCC(C(C#N)CCCNC(=O)c4ccccc4O)CC3)CC2)c1 |
| InChI | InChI=1S/C31H38ClN5O2/c32-28-12-9-24(21-33)20-29(28)37-18-16-36(17-19-37)15-13-23-7-10-25(11-8-23)26(22-34)4-3-14-35-31(39)27-5-1-2-6-30(27)38/h1-2,5-6,9,12,20,23,25-26,38H,3-4,7-8,10-11,13-19H2,(H,35,39) |
| InChIKey | IMPDAVHKHVDZRV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.13 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|