C17H16O5 — CID 91469122
2,3-bis(4-hydroxy-3-methoxyphenyl)prop-2-enal (PubChem CID 91469122) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2,3-bis(4-hydroxy-3-methoxyphenyl)prop-2-enal.
| Compound Name | 2,3-bis(4-hydroxy-3-methoxyphenyl)prop-2-enal |
|---|---|
| PubChem CID | 91469122 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2,3-bis(4-hydroxy-3-methoxyphenyl)prop-2-enal |
| SMILES | COc1cc(C=C(C=O)c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C17H16O5/c1-21-16-8-11(3-5-14(16)19)7-13(10-18)12-4-6-15(20)17(9-12)22-2/h3-10,19-20H,1-2H3 |
| InChIKey | IDJCIWTUMGTOMT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|