About 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine
2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine (PubChem CID 91472797) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine.
Analyze 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine?
The IUPAC name of 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine (CID 91472797) is 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine.
What is the SMILES notation for 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine?
The canonical SMILES for 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine is CC1=CC2=C(CCC(C)=N2)C1.
What is the InChIKey of 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine?
The InChIKey is CAFHBVZXAKLGDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-7-5-9-4-3-8(2)11-10(9)6-7/h6H,3-5H2,1-2H3.
What are the key properties of 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine?
2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine has a molecular weight of 147.22 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4,5-dihydro-3H-cyclopenta[b]pyridine is sourced from PubChem (CID 91472797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).