C38H39BrN2 — CID 91473461
3-[3-[(3-bromo-2,4,6-trimethylphenyl)-(2,4,6-trimethyl-3-pyridin-3-ylphenyl)methyl]-2,4,6-trimethylphenyl]pyridine (PubChem CID 91473461) has the molecular formula C38H39BrN2 and a molecular weight of 603.65 g/mol. Its IUPAC name is 3-[3-[(3-bromo-2,4,6-trimethylphenyl)-(2,4,6-trimethyl-3-pyridin-3-ylphenyl)methyl]-2,4,6-trimethylphenyl]pyridine.
| Compound Name | 3-[3-[(3-bromo-2,4,6-trimethylphenyl)-(2,4,6-trimethyl-3-pyridin-3-ylphenyl)methyl]-2,4,6-trimethylphenyl]pyridine |
|---|---|
| PubChem CID | 91473461 |
| Molecular Formula | C38H39BrN2 |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | 3-[3-[(3-bromo-2,4,6-trimethylphenyl)-(2,4,6-trimethyl-3-pyridin-3-ylphenyl)methyl]-2,4,6-trimethylphenyl]pyridine |
| SMILES | Cc1cc(C)c(C(c2c(C)cc(C)c(-c3cccnc3)c2C)c2c(C)cc(C)c(-c3cccnc3)c2C)c(C)c1Br |
| InChI | InChI=1S/C38H39BrN2/c1-21-16-23(3)34(27(7)32(21)30-12-10-14-40-19-30)37(36-25(5)18-26(6)38(39)29(36)9)35-24(4)17-22(2)33(28(35)8)31-13-11-15-41-20-31/h10-20,37H,1-9H3 |
| InChIKey | BXFWAKFFICBQEX-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|