C13H14N2OS — CID 91475196
N-(4-ethylsulfanylphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 91475196) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is N-(4-ethylsulfanylphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | N-(4-ethylsulfanylphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91475196 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-(4-ethylsulfanylphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | CCSc1ccc(NC(=O)c2cc[nH]c2)cc1 |
| InChI | InChI=1S/C13H14N2OS/c1-2-17-12-5-3-11(4-6-12)15-13(16)10-7-8-14-9-10/h3-9,14H,2H2,1H3,(H,15,16) |
| InChIKey | MWRFSJJQBZTTAB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |