C23H32O5 — CID 91475598
3-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2-hydroxy-3-oxopropanoic acid (PubChem CID 91475598) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is 3-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2-hydroxy-3-oxopropanoic acid.
| Compound Name | 3-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2-hydroxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 91475598 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 3-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2-hydroxy-3-oxopropanoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CCOC(=O)C(O)C(=O)O |
| InChI | InChI=1S/C23H32O5/c1-16(11-12-19-18(3)10-7-14-23(19,4)5)8-6-9-17(2)13-15-28-22(27)20(24)21(25)26/h6,8-9,11-13,20,24H,7,10,14-15H2,1-5H3,(H,25,26) |
| InChIKey | QGEJWWWVGYJEKE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|